C24H23BrFNO4S — CID 19228813
methyl 2-[[2-(2-bromo-4-propylphenoxy)acetyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate (PubChem CID 19228813) has the molecular formula C24H23BrFNO4S and a molecular weight of 520.42 g/mol. Its IUPAC name is methyl 2-[[2-(2-bromo-4-propylphenoxy)acetyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(2-bromo-4-propylphenoxy)acetyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19228813 |
| Molecular Formula | C24H23BrFNO4S |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | methyl 2-[[2-(2-bromo-4-propylphenoxy)acetyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate |
| SMILES | CCCc1ccc(OCC(=O)Nc2sc(C)c(-c3ccc(F)cc3)c2C(=O)OC)c(Br)c1 |
| InChI | InChI=1S/C24H23BrFNO4S/c1-4-5-15-6-11-19(18(25)12-15)31-13-20(28)27-23-22(24(29)30-3)21(14(2)32-23)16-7-9-17(26)10-8-16/h6-12H,4-5,13H2,1-3H3,(H,27,28) |
| InChIKey | LKHMAHWVVWWSCK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|