C27H21BrClNO4S — CID 19217972
methyl 2-[[2-(2-bromo-4-phenylphenoxy)acetyl]amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate (PubChem CID 19217972) has the molecular formula C27H21BrClNO4S and a molecular weight of 570.89 g/mol. Its IUPAC name is methyl 2-[[2-(2-bromo-4-phenylphenoxy)acetyl]amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(2-bromo-4-phenylphenoxy)acetyl]amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19217972 |
| Molecular Formula | C27H21BrClNO4S |
| Molecular Weight | 570.89 g/mol |
| Exact Mass | 569.01 |
| IUPAC Name | methyl 2-[[2-(2-bromo-4-phenylphenoxy)acetyl]amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)COc2ccc(-c3ccccc3)cc2Br)sc(C)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H21BrClNO4S/c1-16-24(19-9-6-10-20(29)13-19)25(27(32)33-2)26(35-16)30-23(31)15-34-22-12-11-18(14-21(22)28)17-7-4-3-5-8-17/h3-14H,15H2,1-2H3,(H,30,31) |
| InChIKey | KJJBOMVSNPOPPG-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.89 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|