C23H22ClNO4S — CID 19218561
methyl 4-(3-chlorophenyl)-2-[[2-(3-ethylphenoxy)acetyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 19218561) has the molecular formula C23H22ClNO4S and a molecular weight of 443.95 g/mol. Its IUPAC name is methyl 4-(3-chlorophenyl)-2-[[2-(3-ethylphenoxy)acetyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 4-(3-chlorophenyl)-2-[[2-(3-ethylphenoxy)acetyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19218561 |
| Molecular Formula | C23H22ClNO4S |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | methyl 4-(3-chlorophenyl)-2-[[2-(3-ethylphenoxy)acetyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | CCc1cccc(OCC(=O)Nc2sc(C)c(-c3cccc(Cl)c3)c2C(=O)OC)c1 |
| InChI | InChI=1S/C23H22ClNO4S/c1-4-15-7-5-10-18(11-15)29-13-19(26)25-22-21(23(27)28-3)20(14(2)30-22)16-8-6-9-17(24)12-16/h5-12H,4,13H2,1-3H3,(H,25,26) |
| InChIKey | ANBYVQJBJCUXIV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|