C24H24ClNO3S — CID 19211053
methyl 2-[(4-tert-butylbenzoyl)amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate (PubChem CID 19211053) has the molecular formula C24H24ClNO3S and a molecular weight of 441.98 g/mol. Its IUPAC name is methyl 2-[(4-tert-butylbenzoyl)amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(4-tert-butylbenzoyl)amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19211053 |
| Molecular Formula | C24H24ClNO3S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | methyl 2-[(4-tert-butylbenzoyl)amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccc(C(C)(C)C)cc2)sc(C)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H24ClNO3S/c1-14-19(16-7-6-8-18(25)13-16)20(23(28)29-5)22(30-14)26-21(27)15-9-11-17(12-10-15)24(2,3)4/h6-13H,1-5H3,(H,26,27) |
| InChIKey | APVTYBBFEDIMPI-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|