C18H18ClNO4S — CID 45154361
methyl 4-(3-chlorophenyl)-5-methyl-2-(oxolane-2-carbonylamino)thiophene-3-carboxylate (PubChem CID 45154361) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is methyl 4-(3-chlorophenyl)-5-methyl-2-(oxolane-2-carbonylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-(3-chlorophenyl)-5-methyl-2-(oxolane-2-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 45154361 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | methyl 4-(3-chlorophenyl)-5-methyl-2-(oxolane-2-carbonylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C2CCCO2)sc(C)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H18ClNO4S/c1-10-14(11-5-3-6-12(19)9-11)15(18(22)23-2)17(25-10)20-16(21)13-7-4-8-24-13/h3,5-6,9,13H,4,7-8H2,1-2H3,(H,20,21) |
| InChIKey | XDRUYFFGTBCMNS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|