C22H17Cl2NO3S — CID 19220077
methyl 4-(3-chlorophenyl)-2-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 19220077) has the molecular formula C22H17Cl2NO3S and a molecular weight of 446.36 g/mol. Its IUPAC name is methyl 4-(3-chlorophenyl)-2-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 4-(3-chlorophenyl)-2-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19220077 |
| Molecular Formula | C22H17Cl2NO3S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | methyl 4-(3-chlorophenyl)-2-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)/C=C/c2cccc(Cl)c2)sc(C)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H17Cl2NO3S/c1-13-19(15-6-4-8-17(24)12-15)20(22(27)28-2)21(29-13)25-18(26)10-9-14-5-3-7-16(23)11-14/h3-12H,1-2H3,(H,25,26)/b10-9+ |
| InChIKey | YIVCRGZKLZHPNH-MDZDMXLPSA-N |
| XLogP | 6.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|