C26H26ClNO4S — CID 19219564
methyl 2-[[(E)-3-(2-butoxyphenyl)prop-2-enoyl]amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate (PubChem CID 19219564) has the molecular formula C26H26ClNO4S and a molecular weight of 484.02 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(2-butoxyphenyl)prop-2-enoyl]amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(E)-3-(2-butoxyphenyl)prop-2-enoyl]amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19219564 |
| Molecular Formula | C26H26ClNO4S |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | methyl 2-[[(E)-3-(2-butoxyphenyl)prop-2-enoyl]amino]-4-(3-chlorophenyl)-5-methylthiophene-3-carboxylate |
| SMILES | CCCCOc1ccccc1/C=C/C(=O)Nc1sc(C)c(-c2cccc(Cl)c2)c1C(=O)OC |
| InChI | InChI=1S/C26H26ClNO4S/c1-4-5-15-32-21-12-7-6-9-18(21)13-14-22(29)28-25-24(26(30)31-3)23(17(2)33-25)19-10-8-11-20(27)16-19/h6-14,16H,4-5,15H2,1-3H3,(H,28,29)/b14-13+ |
| InChIKey | IZGJESVIFLQTCK-BUHFOSPRSA-N |
| XLogP | 6.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|