C29H32ClNO5S — CID 19212100
methyl 4-(3-chlorophenyl)-2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 19212100) has the molecular formula C29H32ClNO5S and a molecular weight of 542.10 g/mol. Its IUPAC name is methyl 4-(3-chlorophenyl)-2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 4-(3-chlorophenyl)-2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19212100 |
| Molecular Formula | C29H32ClNO5S |
| Molecular Weight | 542.10 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | methyl 4-(3-chlorophenyl)-2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)Nc2sc(C)c(-c3cccc(Cl)c3)c2C(=O)OC)cc1OC |
| InChI | InChI=1S/C29H32ClNO5S/c1-5-6-7-8-16-36-23-14-12-20(17-24(23)34-3)13-15-25(32)31-28-27(29(33)35-4)26(19(2)37-28)21-10-9-11-22(30)18-21/h9-15,17-18H,5-8,16H2,1-4H3,(H,31,32)/b15-13+ |
| InChIKey | HJZUJMIDOQKHFT-FYWRMAATSA-N |
| XLogP | 7.78 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.10 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|