C29H32N2O7S — CID 19195292
ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate (PubChem CID 19195292) has the molecular formula C29H32N2O7S and a molecular weight of 552.65 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19195292 |
| Molecular Formula | C29H32N2O7S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate |
| SMILES | CCCCCOc1ccc(/C=C/C(=O)Nc2sc(C)c(-c3ccc([N+](=O)[O-])cc3)c2C(=O)OCC)cc1OC |
| InChI | InChI=1S/C29H32N2O7S/c1-5-7-8-17-38-23-15-9-20(18-24(23)36-4)10-16-25(32)30-28-27(29(33)37-6-2)26(19(3)39-28)21-11-13-22(14-12-21)31(34)35/h9-16,18H,5-8,17H2,1-4H3,(H,30,32)/b16-10+ |
| InChIKey | WQWFQBRQLCWSGF-MHWRWJLKSA-N |
| XLogP | 7.04 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|