C28H31NO5S — CID 19174430
ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 19174430) has the molecular formula C28H31NO5S and a molecular weight of 493.63 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19174430 |
| Molecular Formula | C28H31NO5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCCCCOc1ccc(/C=C/C(=O)Nc2scc(-c3ccccc3)c2C(=O)OCC)cc1OC |
| InChI | InChI=1S/C28H31NO5S/c1-4-6-10-17-34-23-15-13-20(18-24(23)32-3)14-16-25(30)29-27-26(28(31)33-5-2)22(19-35-27)21-11-8-7-9-12-21/h7-9,11-16,18-19H,4-6,10,17H2,1-3H3,(H,29,30)/b16-14+ |
| InChIKey | FFIICLRFRDUBJI-JQIJEIRASA-N |
| XLogP | 6.82 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|