C27H29NO5S — CID 4074712
ethyl 4-(3,4-dimethylphenyl)-2-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate (PubChem CID 4074712) has the molecular formula C27H29NO5S and a molecular weight of 479.60 g/mol. Its IUPAC name is ethyl 4-(3,4-dimethylphenyl)-2-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(3,4-dimethylphenyl)-2-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4074712 |
| Molecular Formula | C27H29NO5S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | ethyl 4-(3,4-dimethylphenyl)-2-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(=O)C=Cc1ccc(OCC)c(OC)c1 |
| InChI | InChI=1S/C27H29NO5S/c1-6-32-22-12-9-19(15-23(22)31-5)10-13-24(29)28-26-25(27(30)33-7-2)21(16-34-26)20-11-8-17(3)18(4)14-20/h8-16H,6-7H2,1-5H3,(H,28,29) |
| InChIKey | SGYRTQXWRZRNPO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|