C29H33NO6S — CID 19203039
ethyl 2-[[(E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 19203039) has the molecular formula C29H33NO6S and a molecular weight of 523.65 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19203039 |
| Molecular Formula | C29H33NO6S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | ethyl 2-[[(E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)/C=C/c1ccc(OCCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C29H33NO6S/c1-6-35-29(32)27-23(21-9-11-22(33-4)12-10-21)18-37-28(27)30-26(31)14-8-20-7-13-24(25(17-20)34-5)36-16-15-19(2)3/h7-14,17-19H,6,15-16H2,1-5H3,(H,30,31)/b14-8+ |
| InChIKey | ABVPGADECRHTSC-RIYZIHGNSA-N |
| XLogP | 6.69 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|