C28H30FNO5S — CID 19236852
ethyl 2-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 19236852) has the molecular formula C28H30FNO5S and a molecular weight of 511.62 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19236852 |
| Molecular Formula | C28H30FNO5S |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | ethyl 2-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCCCOc1ccc(/C=C/C(=O)Nc2scc(-c3ccc(F)cc3)c2C(=O)OCC)cc1OCC |
| InChI | InChI=1S/C28H30FNO5S/c1-4-7-16-35-23-14-8-19(17-24(23)33-5-2)9-15-25(31)30-27-26(28(32)34-6-3)22(18-36-27)20-10-12-21(29)13-11-20/h8-15,17-18H,4-7,16H2,1-3H3,(H,30,31)/b15-9+ |
| InChIKey | ILJPQDREPVZFAT-OQLLNIDSSA-N |
| XLogP | 6.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|