C30H35NO5S — CID 19236848
ethyl 2-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 19236848) has the molecular formula C30H35NO5S and a molecular weight of 521.68 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19236848 |
| Molecular Formula | C30H35NO5S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | ethyl 2-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | CCCCOc1ccc(/C=C/C(=O)Nc2scc(-c3ccc(C)c(C)c3)c2C(=O)OCC)cc1OCC |
| InChI | InChI=1S/C30H35NO5S/c1-6-9-16-36-25-14-11-22(18-26(25)34-7-2)12-15-27(32)31-29-28(30(33)35-8-3)24(19-37-29)23-13-10-20(4)21(5)17-23/h10-15,17-19H,6-9,16H2,1-5H3,(H,31,32)/b15-12+ |
| InChIKey | JXGBRXDRHBHJBQ-NTCAYCPXSA-N |
| XLogP | 7.44 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|