C28H31NO6S — CID 19184860
ethyl 2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate (PubChem CID 19184860) has the molecular formula C28H31NO6S and a molecular weight of 509.62 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19184860 |
| Molecular Formula | C28H31NO6S |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | ethyl 2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OCC)cc2)csc1NC(=O)/C=C/c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C28H31NO6S/c1-5-32-21-13-11-20(12-14-21)22-18-36-27(26(22)28(31)35-8-4)29-25(30)16-10-19-9-15-23(33-6-2)24(17-19)34-7-3/h9-18H,5-8H2,1-4H3,(H,29,30)/b16-10+ |
| InChIKey | LZSVEOUIHRMLOK-MHWRWJLKSA-N |
| XLogP | 6.44 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|