C32H31NO6S — CID 19177010
ethyl 2-[[(E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 19177010) has the molecular formula C32H31NO6S and a molecular weight of 557.67 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19177010 |
| Molecular Formula | C32H31NO6S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | ethyl 2-[[(E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)/C=C/c1ccc(OCc2ccccc2C)c(OC)c1 |
| InChI | InChI=1S/C32H31NO6S/c1-5-38-32(35)30-26(23-12-14-25(36-3)15-13-23)20-40-31(30)33-29(34)17-11-22-10-16-27(28(18-22)37-4)39-19-24-9-7-6-8-21(24)2/h6-18,20H,5,19H2,1-4H3,(H,33,34)/b17-11+ |
| InChIKey | YOOMPKYICYXOKZ-GZTJUZNOSA-N |
| XLogP | 7.15 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|