C32H30ClNO7S — CID 19184839
ethyl 2-[[(E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate (PubChem CID 19184839) has the molecular formula C32H30ClNO7S and a molecular weight of 608.11 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19184839 |
| Molecular Formula | C32H30ClNO7S |
| Molecular Weight | 608.11 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | ethyl 2-[[(E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)c(OC)c2)csc1NC(=O)/C=C/c1ccc(OCc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C32H30ClNO7S/c1-5-40-32(36)30-24(22-10-14-25(37-2)28(17-22)39-4)19-42-31(30)34-29(35)15-9-20-8-13-26(27(16-20)38-3)41-18-21-6-11-23(33)12-7-21/h6-17,19H,5,18H2,1-4H3,(H,34,35)/b15-9+ |
| InChIKey | NIRPWVQKOSUYNR-OQLLNIDSSA-N |
| XLogP | 7.50 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.11 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|