C26H27NO5S — CID 19199796
methyl 2-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-(4-ethylphenyl)thiophene-3-carboxylate (PubChem CID 19199796) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-(4-ethylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-(4-ethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19199796 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | methyl 2-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-(4-ethylphenyl)thiophene-3-carboxylate |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2scc(-c3ccc(CC)cc3)c2C(=O)OC)cc1OC |
| InChI | InChI=1S/C26H27NO5S/c1-5-17-7-11-19(12-8-17)20-16-33-25(24(20)26(29)31-4)27-23(28)14-10-18-9-13-21(32-6-2)22(15-18)30-3/h7-16H,5-6H2,1-4H3,(H,27,28)/b14-10+ |
| InChIKey | XEYBZKWPAXRNNH-GXDHUFHOSA-N |
| XLogP | 5.82 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|