C24H22FNO5S — CID 1183191
ethyl 2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 1183191) has the molecular formula C24H22FNO5S and a molecular weight of 455.51 g/mol. Its IUPAC name is ethyl 2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1183191 |
| Molecular Formula | C24H22FNO5S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | ethyl 2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)C=Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H22FNO5S/c1-4-31-24(28)22-18(16-7-9-17(25)10-8-16)14-32-23(22)26-21(27)12-6-15-5-11-19(29-2)20(13-15)30-3/h5-14H,4H2,1-3H3,(H,26,27) |
| InChIKey | VOLOYRIYOZZSIW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|