C31H28BrNO6S — CID 19191982
ethyl 2-[[(E)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 19191982) has the molecular formula C31H28BrNO6S and a molecular weight of 622.54 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19191982 |
| Molecular Formula | C31H28BrNO6S |
| Molecular Weight | 622.54 g/mol |
| Exact Mass | 621.08 |
| IUPAC Name | ethyl 2-[[(E)-3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)/C=C/c1cc(Br)c(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C31H28BrNO6S/c1-4-38-31(35)28-24(22-11-13-23(36-2)14-12-22)19-40-30(28)33-27(34)15-10-21-16-25(32)29(26(17-21)37-3)39-18-20-8-6-5-7-9-20/h5-17,19H,4,18H2,1-3H3,(H,33,34)/b15-10+ |
| InChIKey | PKFTXAQBFMYFKL-XNTDXEJSSA-N |
| XLogP | 7.60 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.54 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|