C30H35NO6S — CID 19203264
methyl 4-(4-ethoxyphenyl)-2-[[(E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 19203264) has the molecular formula C30H35NO6S and a molecular weight of 537.68 g/mol. Its IUPAC name is methyl 4-(4-ethoxyphenyl)-2-[[(E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 4-(4-ethoxyphenyl)-2-[[(E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19203264 |
| Molecular Formula | C30H35NO6S |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | methyl 4-(4-ethoxyphenyl)-2-[[(E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | CCOc1ccc(-c2c(C)sc(NC(=O)/C=C/c3ccc(OCCC(C)C)c(OC)c3)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C30H35NO6S/c1-7-36-23-12-10-22(11-13-23)27-20(4)38-29(28(27)30(33)35-6)31-26(32)15-9-21-8-14-24(25(18-21)34-5)37-17-16-19(2)3/h8-15,18-19H,7,16-17H2,1-6H3,(H,31,32)/b15-9+ |
| InChIKey | JADSQADMWYHVHM-OQLLNIDSSA-N |
| XLogP | 6.99 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|