C25H23Br2NO5S — CID 19228514
methyl 2-[[(E)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]amino]-4-(4-bromophenyl)-5-methylthiophene-3-carboxylate (PubChem CID 19228514) has the molecular formula C25H23Br2NO5S and a molecular weight of 609.34 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]amino]-4-(4-bromophenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(E)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]amino]-4-(4-bromophenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19228514 |
| Molecular Formula | C25H23Br2NO5S |
| Molecular Weight | 609.34 g/mol |
| Exact Mass | 606.97 |
| IUPAC Name | methyl 2-[[(E)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]amino]-4-(4-bromophenyl)-5-methylthiophene-3-carboxylate |
| SMILES | CCOc1c(Br)cc(/C=C/C(=O)Nc2sc(C)c(-c3ccc(Br)cc3)c2C(=O)OC)cc1OC |
| InChI | InChI=1S/C25H23Br2NO5S/c1-5-33-23-18(27)12-15(13-19(23)31-3)6-11-20(29)28-24-22(25(30)32-4)21(14(2)34-24)16-7-9-17(26)10-8-16/h6-13H,5H2,1-4H3,(H,28,29)/b11-6+ |
| InChIKey | YQOKVFBWRFLUDN-IZZDOVSWSA-N |
| XLogP | 7.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.34 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|