C28H30ClNO5S — CID 19211750
methyl 4-(3-chlorophenyl)-2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 19211750) has the molecular formula C28H30ClNO5S and a molecular weight of 528.07 g/mol. Its IUPAC name is methyl 4-(3-chlorophenyl)-2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 4-(3-chlorophenyl)-2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19211750 |
| Molecular Formula | C28H30ClNO5S |
| Molecular Weight | 528.07 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | methyl 4-(3-chlorophenyl)-2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | CCCCCOc1ccc(/C=C/C(=O)Nc2sc(C)c(-c3cccc(Cl)c3)c2C(=O)OC)cc1OC |
| InChI | InChI=1S/C28H30ClNO5S/c1-5-6-7-15-35-22-13-11-19(16-23(22)33-3)12-14-24(31)30-27-26(28(32)34-4)25(18(2)36-27)20-9-8-10-21(29)17-20/h8-14,16-17H,5-7,15H2,1-4H3,(H,30,31)/b14-12+ |
| InChIKey | VXKUABRQJLRAQN-WYMLVPIESA-N |
| XLogP | 7.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.07 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|