C30H34N2O7S — CID 19195349
ethyl 2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate (PubChem CID 19195349) has the molecular formula C30H34N2O7S and a molecular weight of 566.68 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19195349 |
| Molecular Formula | C30H34N2O7S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | ethyl 2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)Nc2sc(C)c(-c3ccc([N+](=O)[O-])cc3)c2C(=O)OCC)cc1OC |
| InChI | InChI=1S/C30H34N2O7S/c1-5-7-8-9-18-39-24-16-10-21(19-25(24)37-4)11-17-26(33)31-29-28(30(34)38-6-2)27(20(3)40-29)22-12-14-23(15-13-22)32(35)36/h10-17,19H,5-9,18H2,1-4H3,(H,31,33)/b17-11+ |
| InChIKey | WAEKTIFFRUQKFJ-GZTJUZNOSA-N |
| XLogP | 7.43 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|