C27H28N2O7S — CID 19195437
ethyl 2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate (PubChem CID 19195437) has the molecular formula C27H28N2O7S and a molecular weight of 524.60 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19195437 |
| Molecular Formula | C27H28N2O7S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | ethyl 2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]-5-methyl-4-(4-nitrophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C/c2ccc(OCC)c(OCC)c2)sc(C)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H28N2O7S/c1-5-34-21-14-8-18(16-22(21)35-6-2)9-15-23(30)28-26-25(27(31)36-7-3)24(17(4)37-26)19-10-12-20(13-11-19)29(32)33/h8-16H,5-7H2,1-4H3,(H,28,30)/b15-9+ |
| InChIKey | QKWWNMVHNDSVNH-OQLLNIDSSA-N |
| XLogP | 6.26 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|