C23H21FN2O3S — CID 84560416
ethyl 2-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate (PubChem CID 84560416) has the molecular formula C23H21FN2O3S and a molecular weight of 424.50 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 84560416 |
| Molecular Formula | C23H21FN2O3S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | ethyl 2-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C/c2ccc(N)cc2)sc(C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H21FN2O3S/c1-3-29-23(28)21-20(16-7-9-17(24)10-8-16)14(2)30-22(21)26-19(27)13-6-15-4-11-18(25)12-5-15/h4-13H,3,25H2,1-2H3,(H,26,27)/b13-6+ |
| InChIKey | ITVQSQYWJDVEQS-AWNIVKPZSA-N |
| XLogP | 5.27 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|