C18H18BrNO3S — CID 5128113
ethyl 2-[3-(4-bromophenyl)prop-2-enoylamino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 5128113) has the molecular formula C18H18BrNO3S and a molecular weight of 408.32 g/mol. Its IUPAC name is ethyl 2-[3-(4-bromophenyl)prop-2-enoylamino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(4-bromophenyl)prop-2-enoylamino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 5128113 |
| Molecular Formula | C18H18BrNO3S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | ethyl 2-[3-(4-bromophenyl)prop-2-enoylamino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C=Cc2ccc(Br)cc2)sc(C)c1C |
| InChI | InChI=1S/C18H18BrNO3S/c1-4-23-18(22)16-11(2)12(3)24-17(16)20-15(21)10-7-13-5-8-14(19)9-6-13/h5-10H,4H2,1-3H3,(H,20,21) |
| InChIKey | CDTJZPPCAHNOTQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|