C22H25BrN2O4S — CID 1219738
ethyl 2-[3-(4-bromophenyl)prop-2-enoylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 1219738) has the molecular formula C22H25BrN2O4S and a molecular weight of 493.42 g/mol. Its IUPAC name is ethyl 2-[3-(4-bromophenyl)prop-2-enoylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(4-bromophenyl)prop-2-enoylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 1219738 |
| Molecular Formula | C22H25BrN2O4S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | ethyl 2-[3-(4-bromophenyl)prop-2-enoylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C=Cc2ccc(Br)cc2)sc(C(=O)N(CC)CC)c1C |
| InChI | InChI=1S/C22H25BrN2O4S/c1-5-25(6-2)21(27)19-14(4)18(22(28)29-7-3)20(30-19)24-17(26)13-10-15-8-11-16(23)12-9-15/h8-13H,5-7H2,1-4H3,(H,24,26) |
| InChIKey | ORTVFKMUYYQPHI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|