C24H30N2O5S — CID 1001069
propan-2-yl 5-(diethylcarbamoyl)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]-4-methylthiophene-3-carboxylate (PubChem CID 1001069) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is propan-2-yl 5-(diethylcarbamoyl)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]-4-methylthiophene-3-carboxylate.
| Compound Name | propan-2-yl 5-(diethylcarbamoyl)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 1001069 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | propan-2-yl 5-(diethylcarbamoyl)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]-4-methylthiophene-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1sc(NC(=O)C=Cc2ccc(OC)cc2)c(C(=O)OC(C)C)c1C |
| InChI | InChI=1S/C24H30N2O5S/c1-7-26(8-2)23(28)21-16(5)20(24(29)31-15(3)4)22(32-21)25-19(27)14-11-17-9-12-18(30-6)13-10-17/h9-15H,7-8H2,1-6H3,(H,25,27) |
| InChIKey | INYRAXOOEGQUPN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|