C20H32N2O4S — CID 5093414
propan-2-yl 5-(diethylcarbamoyl)-2-(2-ethylbutanoylamino)-4-methylthiophene-3-carboxylate (PubChem CID 5093414) has the molecular formula C20H32N2O4S and a molecular weight of 396.55 g/mol. Its IUPAC name is propan-2-yl 5-(diethylcarbamoyl)-2-(2-ethylbutanoylamino)-4-methylthiophene-3-carboxylate.
| Compound Name | propan-2-yl 5-(diethylcarbamoyl)-2-(2-ethylbutanoylamino)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 5093414 |
| Molecular Formula | C20H32N2O4S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | propan-2-yl 5-(diethylcarbamoyl)-2-(2-ethylbutanoylamino)-4-methylthiophene-3-carboxylate |
| SMILES | CCC(CC)C(=O)Nc1sc(C(=O)N(CC)CC)c(C)c1C(=O)OC(C)C |
| InChI | InChI=1S/C20H32N2O4S/c1-8-14(9-2)17(23)21-18-15(20(25)26-12(5)6)13(7)16(27-18)19(24)22(10-3)11-4/h12,14H,8-11H2,1-7H3,(H,21,23) |
| InChIKey | KRCAHKCRRKJROD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |