C21H34N2O4S — CID 4054403
ethyl 5-(diethylcarbamoyl)-2-(2-ethylhexanoylamino)-4-methylthiophene-3-carboxylate (PubChem CID 4054403) has the molecular formula C21H34N2O4S and a molecular weight of 410.58 g/mol. Its IUPAC name is ethyl 5-(diethylcarbamoyl)-2-(2-ethylhexanoylamino)-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-(diethylcarbamoyl)-2-(2-ethylhexanoylamino)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4054403 |
| Molecular Formula | C21H34N2O4S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | ethyl 5-(diethylcarbamoyl)-2-(2-ethylhexanoylamino)-4-methylthiophene-3-carboxylate |
| SMILES | CCCCC(CC)C(=O)Nc1sc(C(=O)N(CC)CC)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C21H34N2O4S/c1-7-12-13-15(8-2)18(24)22-19-16(21(26)27-11-5)14(6)17(28-19)20(25)23(9-3)10-4/h15H,7-13H2,1-6H3,(H,22,24) |
| InChIKey | OMQLITWGNPEXGE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |