C20H31N3O4S — CID 4681804
ethyl 2-(cyclohexylcarbamoylamino)-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 4681804) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is ethyl 2-(cyclohexylcarbamoylamino)-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(cyclohexylcarbamoylamino)-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4681804 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | ethyl 2-(cyclohexylcarbamoylamino)-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)NC2CCCCC2)sc(C(=O)N(CC)CC)c1C |
| InChI | InChI=1S/C20H31N3O4S/c1-5-23(6-2)18(24)16-13(4)15(19(25)27-7-3)17(28-16)22-20(26)21-14-11-9-8-10-12-14/h14H,5-12H2,1-4H3,(H2,21,22,26) |
| InChIKey | JPMSXQNOHHTDPU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |