C14H21N3O2S — CID 874492
2-(cyclohexylcarbamoylamino)-4,5-dimethylthiophene-3-carboxamide (PubChem CID 874492) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-(cyclohexylcarbamoylamino)-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | 2-(cyclohexylcarbamoylamino)-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 874492 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-(cyclohexylcarbamoylamino)-4,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=O)NC2CCCCC2)c(C(N)=O)c1C |
| InChI | InChI=1S/C14H21N3O2S/c1-8-9(2)20-13(11(8)12(15)18)17-14(19)16-10-6-4-3-5-7-10/h10H,3-7H2,1-2H3,(H2,15,18)(H2,16,17,19) |
| InChIKey | VPHUDDMQKZWOGJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |