C21H23FN2O4S — CID 4128602
ethyl 5-(cyclopentylcarbamoyl)-2-[(4-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 4128602) has the molecular formula C21H23FN2O4S and a molecular weight of 418.49 g/mol. Its IUPAC name is ethyl 5-(cyclopentylcarbamoyl)-2-[(4-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-(cyclopentylcarbamoyl)-2-[(4-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4128602 |
| Molecular Formula | C21H23FN2O4S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | ethyl 5-(cyclopentylcarbamoyl)-2-[(4-fluorobenzoyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(F)cc2)sc(C(=O)NC2CCCC2)c1C |
| InChI | InChI=1S/C21H23FN2O4S/c1-3-28-21(27)16-12(2)17(19(26)23-15-6-4-5-7-15)29-20(16)24-18(25)13-8-10-14(22)11-9-13/h8-11,15H,3-7H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | OJDNECKEHJEUIQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |