C22H26N2O4S — CID 1131009
methyl 5-(cyclohexylcarbamoyl)-4-methyl-2-[(4-methylbenzoyl)amino]thiophene-3-carboxylate (PubChem CID 1131009) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is methyl 5-(cyclohexylcarbamoyl)-4-methyl-2-[(4-methylbenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-(cyclohexylcarbamoyl)-4-methyl-2-[(4-methylbenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1131009 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | methyl 5-(cyclohexylcarbamoyl)-4-methyl-2-[(4-methylbenzoyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccc(C)cc2)sc(C(=O)NC2CCCCC2)c1C |
| InChI | InChI=1S/C22H26N2O4S/c1-13-9-11-15(12-10-13)19(25)24-21-17(22(27)28-3)14(2)18(29-21)20(26)23-16-7-5-4-6-8-16/h9-12,16H,4-8H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | QZYLIKQUPDZJPM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |