C20H19F11N2O4S — CID 3269988
ethyl 5-(diethylcarbamoyl)-4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]thiophene-3-carboxylate (PubChem CID 3269988) has the molecular formula C20H19F11N2O4S and a molecular weight of 592.43 g/mol. Its IUPAC name is ethyl 5-(diethylcarbamoyl)-4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-(diethylcarbamoyl)-4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3269988 |
| Molecular Formula | C20H19F11N2O4S |
| Molecular Weight | 592.43 g/mol |
| Exact Mass | 592.09 |
| IUPAC Name | ethyl 5-(diethylcarbamoyl)-4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)sc(C(=O)N(CC)CC)c1C |
| InChI | InChI=1S/C20H19F11N2O4S/c1-5-33(6-2)12(34)10-8(4)9(13(35)37-7-3)11(38-10)32-14(36)15(21)16(22,23)18(26,27)20(30,31)19(28,29)17(15,24)25/h5-7H2,1-4H3,(H,32,36) |
| InChIKey | DXQOCOICVULFHE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|