C18H15F11N2O4S — CID 4108131
ethyl 5-(dimethylcarbamoyl)-4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]thiophene-3-carboxylate (PubChem CID 4108131) has the molecular formula C18H15F11N2O4S and a molecular weight of 564.37 g/mol. Its IUPAC name is ethyl 5-(dimethylcarbamoyl)-4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-(dimethylcarbamoyl)-4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4108131 |
| Molecular Formula | C18H15F11N2O4S |
| Molecular Weight | 564.37 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | ethyl 5-(dimethylcarbamoyl)-4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C18H15F11N2O4S/c1-5-35-11(33)7-6(2)8(10(32)31(3)4)36-9(7)30-12(34)13(19)14(20,21)16(24,25)18(28,29)17(26,27)15(13,22)23/h5H2,1-4H3,(H,30,34) |
| InChIKey | TXWSTXMXVHAFER-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|