C11H16N2O3S — CID 735026
ethyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 735026) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is ethyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 735026 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | ethyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C11H16N2O3S/c1-5-16-11(15)7-6(2)8(17-9(7)12)10(14)13(3)4/h5,12H2,1-4H3 |
| InChIKey | VOFMVGKEJXTNCQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|