C10H15N3O2S — CID 64975344
5-amino-2-N,2-N,4-N,3-tetramethylthiophene-2,4-dicarboxamide (PubChem CID 64975344) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 5-amino-2-N,2-N,4-N,3-tetramethylthiophene-2,4-dicarboxamide.
| Compound Name | 5-amino-2-N,2-N,4-N,3-tetramethylthiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 64975344 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 5-amino-2-N,2-N,4-N,3-tetramethylthiophene-2,4-dicarboxamide |
| SMILES | CNC(=O)c1c(N)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C10H15N3O2S/c1-5-6(9(14)12-2)8(11)16-7(5)10(15)13(3)4/h11H2,1-4H3,(H,12,14) |
| InChIKey | BMKALIZPGSPBBC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|