C13H13FN2OS — CID 114830937
2-amino-5-(2-fluorophenyl)-N,4-dimethylthiophene-3-carboxamide (PubChem CID 114830937) has the molecular formula C13H13FN2OS and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-amino-5-(2-fluorophenyl)-N,4-dimethylthiophene-3-carboxamide.
| Compound Name | 2-amino-5-(2-fluorophenyl)-N,4-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 114830937 |
| Molecular Formula | C13H13FN2OS |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-amino-5-(2-fluorophenyl)-N,4-dimethylthiophene-3-carboxamide |
| SMILES | CNC(=O)c1c(N)sc(-c2ccccc2F)c1C |
| InChI | InChI=1S/C13H13FN2OS/c1-7-10(13(17)16-2)12(15)18-11(7)8-5-3-4-6-9(8)14/h3-6H,15H2,1-2H3,(H,16,17) |
| InChIKey | OBFYLLRFKICCEB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|