C18H19FN2O5S — CID 8661287
ethyl 2-amino-4-[[2-(2-fluorophenyl)acetyl]oxymethyl]-5-(methylcarbamoyl)thiophene-3-carboxylate (PubChem CID 8661287) has the molecular formula C18H19FN2O5S and a molecular weight of 394.42 g/mol. Its IUPAC name is ethyl 2-amino-4-[[2-(2-fluorophenyl)acetyl]oxymethyl]-5-(methylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-4-[[2-(2-fluorophenyl)acetyl]oxymethyl]-5-(methylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 8661287 |
| Molecular Formula | C18H19FN2O5S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | ethyl 2-amino-4-[[2-(2-fluorophenyl)acetyl]oxymethyl]-5-(methylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(C(=O)NC)c1COC(=O)Cc1ccccc1F |
| InChI | InChI=1S/C18H19FN2O5S/c1-3-25-18(24)14-11(15(17(23)21-2)27-16(14)20)9-26-13(22)8-10-6-4-5-7-12(10)19/h4-7H,3,8-9,20H2,1-2H3,(H,21,23) |
| InChIKey | OLKZXBBSKMGGBF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|