C19H19N3O5S — CID 8606996
[5-amino-4-ethoxycarbonyl-2-(methylcarbamoyl)thiophen-3-yl]methyl 1H-indole-3-carboxylate (PubChem CID 8606996) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is [5-amino-4-ethoxycarbonyl-2-(methylcarbamoyl)thiophen-3-yl]methyl 1H-indole-3-carboxylate.
| Compound Name | [5-amino-4-ethoxycarbonyl-2-(methylcarbamoyl)thiophen-3-yl]methyl 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 8606996 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [5-amino-4-ethoxycarbonyl-2-(methylcarbamoyl)thiophen-3-yl]methyl 1H-indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(C(=O)NC)c1COC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H19N3O5S/c1-3-26-19(25)14-12(15(17(23)21-2)28-16(14)20)9-27-18(24)11-8-22-13-7-5-4-6-10(11)13/h4-8,22H,3,9,20H2,1-2H3,(H,21,23) |
| InChIKey | QZPKQYODXRDYDM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|