C18H19NO6S — CID 7514914
diethyl 5-amino-3-(benzoyloxymethyl)thiophene-2,4-dicarboxylate (PubChem CID 7514914) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is diethyl 5-amino-3-(benzoyloxymethyl)thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-amino-3-(benzoyloxymethyl)thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7514914 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | diethyl 5-amino-3-(benzoyloxymethyl)thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C(=O)OCC)c1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO6S/c1-3-23-17(21)13-12(14(26-15(13)19)18(22)24-4-2)10-25-16(20)11-8-6-5-7-9-11/h5-9H,3-4,10,19H2,1-2H3 |
| InChIKey | JNVGJTUUTZZWJQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|