C19H22N2O7S — CID 16524340
diethyl 5-amino-3-[(2-ethoxypyridine-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 16524340) has the molecular formula C19H22N2O7S and a molecular weight of 422.46 g/mol. Its IUPAC name is diethyl 5-amino-3-[(2-ethoxypyridine-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-amino-3-[(2-ethoxypyridine-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 16524340 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | diethyl 5-amino-3-[(2-ethoxypyridine-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C(=O)OCC)c1COC(=O)c1cccnc1OCC |
| InChI | InChI=1S/C19H22N2O7S/c1-4-25-16-11(8-7-9-21-16)17(22)28-10-12-13(18(23)26-5-2)15(20)29-14(12)19(24)27-6-3/h7-9H,4-6,10,20H2,1-3H3 |
| InChIKey | NOCUWRKRPWSZNM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|