C15H19NO6S — CID 7863376
diethyl 5-amino-3-(cyclopropanecarbonyloxymethyl)thiophene-2,4-dicarboxylate (PubChem CID 7863376) has the molecular formula C15H19NO6S and a molecular weight of 341.39 g/mol. Its IUPAC name is diethyl 5-amino-3-(cyclopropanecarbonyloxymethyl)thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-amino-3-(cyclopropanecarbonyloxymethyl)thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7863376 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | diethyl 5-amino-3-(cyclopropanecarbonyloxymethyl)thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C(=O)OCC)c1COC(=O)C1CC1 |
| InChI | InChI=1S/C15H19NO6S/c1-3-20-14(18)10-9(7-22-13(17)8-5-6-8)11(23-12(10)16)15(19)21-4-2/h8H,3-7,16H2,1-2H3 |
| InChIKey | JMQSNRRJDWJZDP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|