C15H24N2O4S — CID 2398073
diethyl 5-amino-3-[(tert-butylamino)methyl]thiophene-2,4-dicarboxylate (PubChem CID 2398073) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is diethyl 5-amino-3-[(tert-butylamino)methyl]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-amino-3-[(tert-butylamino)methyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2398073 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | diethyl 5-amino-3-[(tert-butylamino)methyl]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C(=O)OCC)c1CNC(C)(C)C |
| InChI | InChI=1S/C15H24N2O4S/c1-6-20-13(18)10-9(8-17-15(3,4)5)11(22-12(10)16)14(19)21-7-2/h17H,6-8,16H2,1-5H3 |
| InChIKey | RDKPGRITPXZEDP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|