C13H19NO4S — CID 42656877
diethyl 5-amino-3-propan-2-ylthiophene-2,4-dicarboxylate (PubChem CID 42656877) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is diethyl 5-amino-3-propan-2-ylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-amino-3-propan-2-ylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 42656877 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | diethyl 5-amino-3-propan-2-ylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C(=O)OCC)c1C(C)C |
| InChI | InChI=1S/C13H19NO4S/c1-5-17-12(15)9-8(7(3)4)10(19-11(9)14)13(16)18-6-2/h7H,5-6,14H2,1-4H3 |
| InChIKey | OEYJKDKHYLBMIP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|