C15H25NO2S — CID 63398662
ethyl 3-amino-5-(2-methylbutan-2-yl)-4-propan-2-ylthiophene-2-carboxylate (PubChem CID 63398662) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is ethyl 3-amino-5-(2-methylbutan-2-yl)-4-propan-2-ylthiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-5-(2-methylbutan-2-yl)-4-propan-2-ylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 63398662 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | ethyl 3-amino-5-(2-methylbutan-2-yl)-4-propan-2-ylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(C(C)(C)CC)c(C(C)C)c1N |
| InChI | InChI=1S/C15H25NO2S/c1-7-15(5,6)13-10(9(3)4)11(16)12(19-13)14(17)18-8-2/h9H,7-8,16H2,1-6H3 |
| InChIKey | LHBSSRKEDHNFAH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |