C13H22N2O4S2 — CID 103425653
ethyl 3-amino-5-(3-methylbutylamino)-4-methylsulfonylthiophene-2-carboxylate (PubChem CID 103425653) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is ethyl 3-amino-5-(3-methylbutylamino)-4-methylsulfonylthiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-5-(3-methylbutylamino)-4-methylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 103425653 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | ethyl 3-amino-5-(3-methylbutylamino)-4-methylsulfonylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NCCC(C)C)c(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C13H22N2O4S2/c1-5-19-13(16)10-9(14)11(21(4,17)18)12(20-10)15-7-6-8(2)3/h8,15H,5-7,14H2,1-4H3 |
| InChIKey | DAVSWKDVYXNZHM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |