C12H20N2O3S2 — CID 103425192
1-[3-amino-5-(butylamino)-4-methylsulfonylthiophen-2-yl]propan-1-one (PubChem CID 103425192) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 1-[3-amino-5-(butylamino)-4-methylsulfonylthiophen-2-yl]propan-1-one.
| Compound Name | 1-[3-amino-5-(butylamino)-4-methylsulfonylthiophen-2-yl]propan-1-one |
|---|---|
| PubChem CID | 103425192 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[3-amino-5-(butylamino)-4-methylsulfonylthiophen-2-yl]propan-1-one |
| SMILES | CCCCNc1sc(C(=O)CC)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C12H20N2O3S2/c1-4-6-7-14-12-11(19(3,16)17)9(13)10(18-12)8(15)5-2/h14H,4-7,13H2,1-3H3 |
| InChIKey | JVSFFEQLSBXNPR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|